CAS 118887-71-1

2-Azido-2-methyl-1-phenyl-1-propanone

Description:

2-Azido-2-methyl-1-phenyl-1-propanone, with the CAS number 118887-71-1, is an organic compound characterized by the presence of an azide functional group (-N3) attached to a ketone structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The azido group contributes to its potential as an intermediate in the synthesis of more complex molecules, especially in the field of medicinal chemistry and materials science. However, due to the presence of the azide group, it may also exhibit explosive properties under certain conditions, necessitating careful handling and storage. Additionally, its molecular structure includes a phenyl group, which can influence its physical and chemical properties, such as solubility and stability. Overall, 2-Azido-2-methyl-1-phenyl-1-propanone is a valuable compound in synthetic organic chemistry, albeit with associated safety considerations.

Formula: C₁₀H₁₁N₃O

InChI: InChI=1S/C10H11N3O/c1-10(2,12-13-11)9(14)8-6-4-3-5-7-8/h3-7H,1-2H3

InChI key: InChIKey=IXHRMMWPCNWJQG-UHFFFAOYSA-N

SMILES: C(C(N=[N+]=[N-])(C)C)(=O)C1=CC=CC=C1

Synonyms:

• 2-Azido-2-methyl-1-phenylpropan-1-one
• 2-Azido-2-methyl-1-phenyl-1-propanone
• 1-Propanone, 2-azido-2-methyl-1-phenyl-