CymitQuimica logo

CAS 1188909-23-0

:

β-Oxo-1-(trifluoromethyl)cyclobutanepropanenitrile

Description:
β-Oxo-1-(trifluoromethyl)cyclobutanepropanenitrile is a chemical compound characterized by its unique structural features, including a cyclobutane ring and a trifluoromethyl group. The presence of the β-oxo functional group indicates that it contains a carbonyl (C=O) adjacent to a carbon atom that is part of the cyclobutane structure. The propanenitrile moiety suggests the presence of a cyano group (–C≡N), which contributes to the compound's reactivity and potential applications in organic synthesis. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing the compound's biological activity. This compound may exhibit interesting chemical behavior due to the interplay of its functional groups, making it a candidate for various applications in pharmaceuticals, agrochemicals, or materials science. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in a given reaction or application context.
Formula:C8H8F3NO
InChI:InChI=1S/C8H8F3NO/c9-8(10,11)7(3-1-4-7)6(13)2-5-12/h1-4H2
InChI key:InChIKey=GQACZXXFJWIHTK-UHFFFAOYSA-N
SMILES:C(CC#N)(=O)C1(C(F)(F)F)CCC1
Synonyms:
  • β-Oxo-1-(trifluoromethyl)cyclobutanepropanenitrile
  • Cyclobutanepropanenitrile, β-oxo-1-(trifluoromethyl)-
  • 3-Oxo-3-[1-(trifluoromethyl)cyclobutyl]propanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.