
CAS 1189043-17-1
:3,3′-Dibromo-2,2′-bipyridine
Description:
3,3′-Dibromo-2,2′-bipyridine is an organic compound characterized by the presence of two bromine atoms attached to the 3-position of the bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents such as dichloromethane and ethanol, but has limited solubility in water due to its hydrophobic nature. The presence of bromine substituents enhances its reactivity, making it useful in various chemical reactions, including cross-coupling reactions and as a ligand in coordination chemistry. Additionally, 3,3′-dibromo-2,2′-bipyridine can exhibit interesting electronic properties due to the electron-withdrawing nature of the bromine atoms, which can influence its behavior in different chemical environments. Its applications may extend to fields such as materials science, organic synthesis, and medicinal chemistry, where it can serve as a precursor or intermediate in the synthesis of more complex molecules.
Formula:C10H6Br2N2
InChI:InChI=1S/C10H6Br2N2/c11-7-3-1-5-13-9(7)10-8(12)4-2-6-14-10/h1-6H
InChI key:InChIKey=MCXPUPKYSSCIFG-UHFFFAOYSA-N
SMILES:BrC1=C(N=CC=C1)C2=C(Br)C=CC=N2
Synonyms:- 3-Bromo-2-(3-bromopyridin-2-yl)pyridine
- 3,3′-Dibromo-2,2′-bipyridine
- 2,2′-Bipyridine, 3,3′-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.