CAS 118908-63-7
:di-(isoamyl)dimercaptosuccinate
Description:
Di-(isoamyl)dimercaptosuccinate, identified by its CAS number 118908-63-7, is a chemical compound characterized by its structure, which includes two isoamyl groups and two mercapto (thiol) functional groups attached to a succinate backbone. This compound is typically used as a chelating agent, particularly in applications involving metal ion binding due to the presence of the thiol groups, which can effectively form stable complexes with various metal ions. The isoamyl groups contribute to its hydrophobic characteristics, influencing its solubility and interaction with other substances. Di-(isoamyl)dimercaptosuccinate is often utilized in the fields of materials science and organic chemistry, particularly in formulations requiring enhanced stability or specific reactivity. Safety considerations should be taken into account when handling this compound, as thiols can be malodorous and may pose health risks upon exposure. Overall, its unique structure and properties make it a valuable compound in various chemical applications.
Formula:C14H26O4S2
InChI:InChI=1/C14H26O4S2/c1-9(2)5-7-17-13(15)11(19)12(20)14(16)18-8-6-10(3)4/h9-12,19-20H,5-8H2,1-4H3/t11-,12+
Synonyms:- bis(3-methylbutyl) (2R,3S)-2,3-disulfanylbutanedioate
- Butanedioic acid, 2,3-dimercapto-, bis(3-methylbutyl) ester, (R*,S*)-
- Di-(isoamyl)dimercaptosuccinate
- Diadms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
