CymitQuimica logo

CAS 1189105-59-6

:

7-Bromo-4-chloro-6-methylquinoline

Description:
7-Bromo-4-chloro-6-methylquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 7 and 4 positions, respectively, along with a methyl group at the 6 position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential reactivity due to the halogen substituents, which can participate in nucleophilic substitution reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The presence of halogens often enhances the lipophilicity of the molecule, potentially influencing its pharmacokinetic properties. As with many quinoline derivatives, 7-Bromo-4-chloro-6-methylquinoline may also display fluorescence, which can be useful in various analytical applications. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C10H7BrClN
InChI:InChI=1S/C10H7BrClN/c1-6-4-7-9(12)2-3-13-10(7)5-8(6)11/h2-5H,1H3
InChI key:InChIKey=AWRJHBCWXXOJMI-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(Br)C(C)=C2)N=CC1
Synonyms:
  • 7-Bromo-4-chloro-6-methylquinoline
  • Quinoline, 7-bromo-4-chloro-6-methyl-
Found 1 products.