
CAS 1189105-62-1
:8-Bromo-6-methyl-4-quinolinamine
Description:
8-Bromo-6-methyl-4-quinolinamine is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. The presence of a bromine atom at the 8-position and a methyl group at the 6-position contributes to its unique reactivity and properties. This compound typically exhibits moderate solubility in organic solvents, reflecting its aromatic nature, while its amine functional group can engage in hydrogen bonding, influencing its solubility in polar solvents. The bromine substituent may enhance electrophilic reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, as quinoline derivatives are known for their pharmacological properties, including antimicrobial and antimalarial effects. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, 8-Bromo-6-methyl-4-quinolinamine is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H9BrN2
InChI:InChI=1S/C10H9BrN2/c1-6-4-7-9(12)2-3-13-10(7)8(11)5-6/h2-5H,1H3,(H2,12,13)
InChI key:InChIKey=YMZGGSZAFQVJLD-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=C(C)C1)C(N)=CC=N2
Synonyms:- 8-Bromo-6-methyl-4-quinolinamine
- 4-Quinolinamine, 8-bromo-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.