CymitQuimica logo

CAS 1189105-68-7

:

4-Bromo-6-(trifluoromethoxy)quinoline

Description:
4-Bromo-6-(trifluoromethoxy)quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a bromine atom at the 4-position and a trifluoromethoxy group at the 6-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The trifluoromethoxy group enhances its lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. The bromine substituent can also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound may exhibit fluorescence properties, which can be useful in analytical applications. Its unique structure and functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Safety and handling precautions should be observed due to the presence of halogenated compounds, which can pose environmental and health risks.
Formula:C10H5BrF3NO
InChI:InChI=1S/C10H5BrF3NO/c11-8-3-4-15-9-2-1-6(5-7(8)9)16-10(12,13)14/h1-5H
InChI key:InChIKey=MQWWGBHKEREGLA-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=CC(OC(F)(F)F)=C2)N=CC1
Synonyms:
  • Quinoline, 4-bromo-6-(trifluoromethoxy)-
  • 4-Bromo-6-(trifluoromethoxy)quinoline
  • 4-Bromo-6-trifluoromethoxyquinoline
Found 4 products.