CymitQuimica logo

CAS 1189105-80-3

:

4-Bromo-5,8-difluoro-2-methylquinoline

Description:
4-Bromo-5,8-difluoro-2-methylquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and fluorine substituents at specific positions on the quinoline ring significantly influences its chemical properties and reactivity. The bromine atom typically enhances the compound's electrophilicity, while the fluorine atoms can impart unique electronic characteristics due to their electronegativity. This compound may exhibit interesting biological activity, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the presence of the methyl group contributes to the compound's overall hydrophobicity, which can affect its solubility and interaction with biological systems. Overall, 4-Bromo-5,8-difluoro-2-methylquinoline is a complex molecule with diverse potential applications, driven by its unique structural features and substituents.
Formula:C10H6BrF2N
InChI:InChI=1S/C10H6BrF2N/c1-5-4-6(11)9-7(12)2-3-8(13)10(9)14-5/h2-4H,1H3
InChI key:InChIKey=WVDMOCBEIHHACL-UHFFFAOYSA-N
SMILES:FC=1C2=C(C(Br)=CC(C)=N2)C(F)=CC1
Synonyms:
  • 4-Bromo-5,8-difluoro-2-methylquinoline
  • Quinoline, 4-bromo-5,8-difluoro-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.