CAS 1189105-86-9

7,8-Difluoro-2-propyl-4-quinolinol

Description:

7,8-Difluoro-2-propyl-4-quinolinol is a chemical compound characterized by its quinoline structure, which features a bicyclic aromatic system. The presence of two fluorine atoms at the 7 and 8 positions of the quinoline ring significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The propyl group at the 2-position contributes to its hydrophobic characteristics, which may enhance its interaction with biological membranes. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its CAS number, 1189105-86-9, allows for precise identification in chemical databases. As with many fluorinated compounds, it may demonstrate unique reactivity and stability compared to its non-fluorinated counterparts. The synthesis and characterization of such compounds often involve advanced organic chemistry techniques, and their applications can range from pharmaceuticals to agrochemicals, depending on their specific biological activities and interactions. Safety and handling precautions are essential due to the potential toxicity associated with fluorinated organic compounds.

Formula: C₁₂H₁₁F₂NO

InChI: InChI=1S/C12H11F2NO/c1-2-3-7-6-10(16)8-4-5-9(13)11(14)12(8)15-7/h4-6H,2-3H2,1H3,(H,15,16)

InChI key: InChIKey=ZTGWTXIIQAUNJS-UHFFFAOYSA-N

SMILES: FC=1C2=C(C(O)=CC(CCC)=N2)C=CC1F

Synonyms:

• 7,8-Difluoro-2-propyl-4-quinolinol
• 4-Quinolinol, 7,8-difluoro-2-propyl-