CymitQuimica logo

CAS 1189106-62-4

:

7-Bromo-4-chloro-2,8-dimethylquinoline

Description:
7-Bromo-4-chloro-2,8-dimethylquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 7 and 4 positions, respectively, along with methyl groups at the 2 and 8 positions, contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic nature, which can influence its solubility in organic solvents. The halogen substituents may also impart specific reactivity, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. Additionally, the presence of multiple substituents can affect the compound's electronic properties, potentially impacting its behavior in biological systems or as a ligand in coordination chemistry. Overall, 7-Bromo-4-chloro-2,8-dimethylquinoline is of interest in fields such as medicinal chemistry and materials science, where its unique structure may lead to novel applications.
Formula:C11H9BrClN
InChI:InChI=1S/C11H9BrClN/c1-6-5-10(13)8-3-4-9(12)7(2)11(8)14-6/h3-5H,1-2H3
InChI key:InChIKey=JJOXAYSGWSYGNB-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C(C)=C(Br)C=C2)N=C(C)C1
Synonyms:
  • 7-Bromo-4-chloro-2,8-dimethylquinoline
  • Quinoline, 7-bromo-4-chloro-2,8-dimethyl-
Found 4 products.