CAS 1189106-71-5

1,1-Dimethylethyl 4-[[(4-aminophenyl)methyl]amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[[(4-aminophenyl)methyl]amino]-1-piperidinecarboxylate, identified by its CAS number 1189106-71-5, is a chemical compound characterized by its complex structure, which includes a piperidine ring and an amino group attached to a phenyl moiety. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its reactivity and interactions. The presence of the carboxylate functional group suggests that it may exhibit acidic properties, while the amino group indicates potential basicity. Such characteristics may allow the compound to participate in various chemical reactions, including nucleophilic substitutions or coupling reactions. Additionally, the compound's structure may confer specific biological activities, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity would depend on the solvent and environmental conditions, which are critical for applications in synthesis and biological assays. Overall, this compound's unique features make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₇H₂₇N₃O₂

InChI: InChI=1S/C17H27N3O2/c1-17(2,3)22-16(21)20-10-8-15(9-11-20)19-12-13-4-6-14(18)7-5-13/h4-7,15,19H,8-12,18H2,1-3H3

InChI key: InChIKey=HBKSHEPHTFBUGC-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(NCC2=CC=C(N)C=C2)CC1

Synonyms:

• 1,1-Dimethylethyl 4-[[(4-aminophenyl)methyl]amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-[[(4-aminophenyl)methyl]amino]-, 1,1-dimethylethyl ester

4-(4-amino-benzylamino)-piperidine-1-carboxylic acid tert-butyl ester

CAS: 1189106-71-5

4-(4-amino-benzylamino)-piperidine-1-carboxylic acid tert-butyl ester

Purity: ≥95%

Molecular weight: 305.42g/mol

Ref: 54-OR307774