CAS 1189107-47-8

4,6-Dibromo-2,8-dimethylquinoline

Description:

4,6-Dibromo-2,8-dimethylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features two bromine substituents at the 4 and 6 positions and two methyl groups at the 2 and 8 positions of the quinoline ring. The presence of bromine atoms introduces significant polarity and can enhance the compound's reactivity, making it useful in various chemical reactions, including electrophilic substitutions. The methyl groups contribute to the hydrophobic character of the molecule and can influence its solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its unique structure allows for potential applications in dye synthesis, agrochemicals, or as a building block in organic synthesis. As with many brominated compounds, considerations regarding environmental impact and toxicity are essential for its handling and application.

Formula: C₁₁H₉Br₂N

InChI: InChI=1S/C11H9Br2N/c1-6-3-8(12)5-9-10(13)4-7(2)14-11(6)9/h3-5H,1-2H3

InChI key: InChIKey=FSGAPPHMFXJMQN-UHFFFAOYSA-N

SMILES: BrC=1C2=C(N=C(C)C1)C(C)=CC(Br)=C2

Synonyms:

• Quinoline, 4,6-dibromo-2,8-dimethyl-
• 4,6-Dibromo-2,8-dimethylquinoline