CAS 1189107-50-3

6-Bromo-2,8-dimethyl-4-quinolinamine

Description:

6-Bromo-2,8-dimethyl-4-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a bromine atom at the 6-position and two methyl groups at the 2 and 8 positions contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic nature of the quinoline moiety, which can influence its solubility and biological activity. The amino group at the 4-position can participate in hydrogen bonding, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the bromine substituent can serve as a useful handle for further functionalization. Given its structural features, 6-Bromo-2,8-dimethyl-4-quinolinamine may possess interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₁H₁₁BrN₂

InChI: InChI=1S/C11H11BrN2/c1-6-3-8(12)5-9-10(13)4-7(2)14-11(6)9/h3-5H,1-2H3,(H2,13,14)

InChI key: InChIKey=UCYRPXVGZANXNL-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=C(C)C1)C(C)=CC(Br)=C2

Synonyms:

• 6-Bromo-2,8-dimethyl-4-quinolinamine
• 4-Quinolinamine, 6-bromo-2,8-dimethyl-