CAS 1189107-53-6

4,8-Dibromo-2,6-dimethylquinoline

Description:

4,8-Dibromo-2,6-dimethylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features two bromine substituents at the 4 and 8 positions and two methyl groups at the 2 and 6 positions of the quinoline ring. The presence of bromine atoms contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitution and cross-coupling reactions. The methyl groups enhance the lipophilicity of the molecule, which may influence its solubility and biological activity. As a halogenated derivative, it may exhibit unique properties such as increased stability and altered electronic characteristics compared to non-brominated analogs. This compound may be of interest in fields such as medicinal chemistry, materials science, and organic synthesis, where its specific structural features can be leveraged for the development of new pharmaceuticals or functional materials. Safety and handling precautions should be observed due to the potential toxicity associated with brominated compounds.

Formula: C₁₁H₉Br₂N

InChI: InChI=1S/C11H9Br2N/c1-6-3-8-9(12)5-7(2)14-11(8)10(13)4-6/h3-5H,1-2H3

InChI key: InChIKey=QCPUZRNXOYSLNO-UHFFFAOYSA-N

SMILES: BrC=1C2=C(N=C(C)C1)C(Br)=CC(C)=C2

Synonyms:

• 4,8-Dibromo-2,6-dimethylquinoline
• Quinoline, 4,8-dibromo-2,6-dimethyl-