CAS 1189107-54-7

7-Bromo-4-hydroxy-8-methyl-3-quinolinecarboxylic acid

Description:

7-Bromo-4-hydroxy-8-methyl-3-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a bromine atom at the 7-position, a hydroxyl group at the 4-position, and a methyl group at the 8-position, along with a carboxylic acid functional group at the 3-position. These functional groups contribute to its potential biological activity and solubility properties. The presence of the bromine atom may enhance its reactivity and influence its interactions in various chemical environments. The hydroxyl group can participate in hydrogen bonding, which may affect its solubility in polar solvents. Additionally, the methyl group can influence the compound's steric properties and overall stability. This compound may be of interest in medicinal chemistry and research due to its structural features, which could be relevant for developing pharmaceuticals or studying biological pathways. However, specific applications and biological activities would require further investigation and validation through experimental studies.

Formula: C₁₁H₈BrNO₃

InChI: InChI=1S/C11H8BrNO3/c1-5-8(12)3-2-6-9(5)13-4-7(10(6)14)11(15)16/h2-4H,1H3,(H,13,14)(H,15,16)

InChI key: InChIKey=CSCYIJACNBZKHZ-UHFFFAOYSA-N

SMILES: OC=1C2=C(C(C)=C(Br)C=C2)N=CC1C(O)=O

Synonyms:

• 3-Quinolinecarboxylic acid, 7-bromo-4-hydroxy-8-methyl-
• 7-Bromo-4-hydroxy-8-methyl-3-quinolinecarboxylic acid
• 7-Bromo-4-hydroxy-8-methylquinoline-3-carboxylic acid

7-Bromo-4-hydroxy-8-methylquinoline-3-carboxylic acid

CAS: 1189107-54-7

7-Bromo-4-hydroxy-8-methylquinoline-3-carboxylic acid

Purity: ≥95%

Molecular weight: 282.09g/mol

Ref: 54-OR309310