CAS 1189107-57-0

4-Bromo-6-chloro-8-methoxy-2-methylquinoline

Description:

4-Bromo-6-chloro-8-methoxy-2-methylquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 4 and 6 positions, respectively, along with a methoxy group at the 8 position and a methyl group at the 2 position, contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic nature and the presence of halogen and methoxy groups, which can influence its solubility in organic solvents. The halogen substituents may also impart biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, due to the reactivity of the halogen atoms. Its specific applications and reactivity would depend on further studies and evaluations in the context of its potential uses in pharmaceuticals or agrochemicals.

Formula: C₁₁H₉BrClNO

InChI: InChI=1S/C11H9BrClNO/c1-6-3-9(12)8-4-7(13)5-10(15-2)11(8)14-6/h3-5H,1-2H3

InChI key: InChIKey=OBYWDMFESDUBEB-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C=C(Cl)C1)C(Br)=CC(C)=N2

Synonyms:

• Quinoline, 4-bromo-6-chloro-8-methoxy-2-methyl-
• 4-Bromo-6-chloro-8-methoxy-2-methylquinoline