
CAS 1189107-58-1
:4,6-Dibromo-8-methyl-2-propylquinoline
Description:
4,6-Dibromo-8-methyl-2-propylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of two bromine atoms at the 4 and 6 positions, along with a methyl group at the 8 position and a propyl group at the 2 position, contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the presence of multiple aromatic and aliphatic groups, which can influence its solubility in organic solvents. The bromine substituents may also impart specific reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, the compound may exhibit biological activity, as many quinoline derivatives are known for their pharmacological properties. However, specific data on its toxicity, stability, and reactivity would require further investigation through experimental studies or literature review. Overall, 4,6-Dibromo-8-methyl-2-propylquinoline represents a complex structure with potential applications in organic synthesis and medicinal chemistry.
Formula:C13H13Br2N
InChI:InChI=1S/C13H13Br2N/c1-3-4-10-7-12(15)11-6-9(14)5-8(2)13(11)16-10/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=OXQCVUQSDDWGOS-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(Br)=CC(CCC)=N2)C=C(Br)C1
Synonyms:- 4,6-Dibromo-8-methyl-2-propylquinoline
- Quinoline, 4,6-dibromo-8-methyl-2-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.