CAS 1189107-60-5

4-Bromo-8-chloro-5-methoxy-2-methylquinoline

Description:

4-Bromo-8-chloro-5-methoxy-2-methylquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 4 and 8 positions, respectively, along with a methoxy group at the 5 position and a methyl group at the 2 position, contributes to its unique chemical properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, possibly influencing its pharmacological profile. Additionally, the presence of halogen atoms can enhance lipophilicity and affect the compound's reactivity and stability. The methoxy group may also influence solubility and polarity. As with many quinoline derivatives, this compound could be investigated for applications in areas such as antimicrobial, antimalarial, or anticancer research. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₁H₉BrClNO

InChI: InChI=1S/C11H9BrClNO/c1-6-5-7(12)10-9(15-2)4-3-8(13)11(10)14-6/h3-5H,1-2H3

InChI key: InChIKey=GLLWLEMKCDQKTB-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(N=C(C)C=C2Br)C(Cl)=CC1

Synonyms:

• Quinoline, 4-bromo-8-chloro-5-methoxy-2-methyl-
• 4-Bromo-8-chloro-5-methoxy-2-methylquinoline