
CAS 1189126-31-5
:B-[3-Methoxy-4-(2-methoxyethoxy)phenyl]boronic acid
Description:
B-[3-Methoxy-4-(2-methoxyethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with methoxy and methoxyethoxy groups, enhancing its solubility and reactivity. The methoxy groups contribute to the electron-donating properties, which can influence the compound's reactivity in cross-coupling reactions, such as Suzuki-Miyaura coupling. Additionally, the boronic acid moiety allows for the formation of boronate esters, facilitating the development of complex organic molecules. This compound may also exhibit potential biological activity, making it of interest in pharmaceutical research. Its structural characteristics suggest it could be utilized in the development of targeted therapies or as a building block in the synthesis of more complex organic compounds. Overall, B-[3-Methoxy-4-(2-methoxyethoxy)phenyl]boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C10H15BO5
InChI:InChI=1S/C10H15BO5/c1-14-5-6-16-9-4-3-8(11(12)13)7-10(9)15-2/h3-4,7,12-13H,5-6H2,1-2H3
InChI key:InChIKey=YUBMDYZNCBFIEJ-UHFFFAOYSA-N
SMILES:O(CCOC)C1=C(OC)C=C(B(O)O)C=C1
Synonyms:- B-[3-Methoxy-4-(2-methoxyethoxy)phenyl]boronic acid
- Boronic acid, B-[3-methoxy-4-(2-methoxyethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
