CAS 118916-68-0
:(T-4)-(L-Alaninato-κN,κO)diphenylboron
Description:
(T-4)-(L-Alaninato-κN,κO)diphenylboron, with the CAS number 118916-68-0, is a boron-containing compound that features a diphenylboron moiety coordinated to an L-alaninate ligand. This compound exhibits characteristics typical of organoboron complexes, including potential applications in organic synthesis and materials science. The presence of the L-alaninate ligand, which is derived from the amino acid alanine, imparts biological relevance and may enhance solubility in polar solvents. The coordination of the alaninate to the boron center occurs through both nitrogen and oxygen atoms, indicating a bidentate binding mode that can influence the compound's stability and reactivity. Additionally, the diphenyl groups contribute to the compound's electronic properties, potentially allowing for applications in photonics or as a precursor in the synthesis of other boron-based materials. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, showcasing the versatility of boron in various chemical contexts.
Formula:C15H16BNO2
InChI:InChI=1S/C15H16BNO2/c1-12-15(18)19-16(17-12,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12H,17H2,1H3
InChI key:InChIKey=WRSXDKBRFMQHOW-UHFFFAOYSA-N
SMILES:CC1[NH2][B+3]([O-]C1=O)([C-]=2C=CC=CC2)[C-]=3C=CC=CC3
Synonyms:- (T-4)-(L-Alaninato-κN,κO)diphenylboron
- Boron, (L-alaninato-N,O)diphenyl-, (T-4)-
- Boron, (L-alaninato-κN,κO)diphenyl-, (T-4)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
