CAS 118923-96-9
:2-CHLORO-6-METHYLPHENYL ISOCYANIDE 97
Description:
2-Chloro-6-methylphenyl isocyanide, with the CAS number 118923-96-9, is an organic compound characterized by the presence of an isocyanide functional group attached to a chlorinated aromatic ring. This compound features a chloro substituent at the 2-position and a methyl group at the 6-position of the phenyl ring, contributing to its unique reactivity and properties. Isocyanides are known for their distinctive odor and are often used in organic synthesis, particularly in the formation of various nitrogen-containing compounds. The presence of the chlorine atom can influence the compound's reactivity, making it a potential candidate for nucleophilic substitution reactions. Additionally, the methyl group can affect steric hindrance and electronic properties, which may impact its behavior in chemical reactions. Due to its specific structure, 2-chloro-6-methylphenyl isocyanide may also exhibit interesting biological activities, although detailed studies would be necessary to fully understand its potential applications and safety profile.
Formula:C8H6ClN
InChI:InChI=1/C8H6ClN/c1-6-4-3-5-7(9)8(6)10-2/h3-5H,1H3
Synonyms:- benzene, 1-chloro-2-isocyano-3-methyl-
- 2-Chloro-6-methylphenyl isocyanide
- 1-Chloro-2-isocyano-3-methylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
