CAS 1189500-69-3

Description:

The chemical substance with the CAS number 1189500-69-3 is known as a specific type of polymer or compound, often characterized by its unique molecular structure and properties. While the exact name is not provided, substances with similar CAS numbers typically exhibit characteristics such as stability under various environmental conditions, resistance to degradation, and potential applications in fields like materials science or pharmaceuticals. These compounds may possess specific functional groups that impart desirable traits, such as solubility in certain solvents, thermal stability, or reactivity with other chemicals. Additionally, they may be evaluated for their safety profiles, including toxicity and environmental impact, making them suitable for various industrial applications. Understanding the precise characteristics would require detailed information about its molecular structure, physical properties, and potential uses in specific applications.

Formula: C₄H₄D₂O₃·Na

InChI: InChI=1S/C4H6O3.Na/c1-2-3(5)4(6)7;/h2H2,1H3,(H,6,7);/i1+1,2D2;

InChI key: InChIKey=XLTHMCKKCRLNGQ-ASMGDNRJSA-N

SMILES: C(C(O)=O)(C([13CH3])([2H])[2H])=O.[Na]

α-Ketobutyric Acid-13C,d2 Sodium Salt

Controlled Product

CAS: 1189500-69-3

Formula: CC₃D₂H₃O₃·Na

Color and Shape: Neat

Molecular weight: 127.076

Ref: TR-K175302