CymitQuimica logo

CAS 118959-44-7

:

1H-Indole-3-carboxamide, 1-methyl-

Description:
1H-Indole-3-carboxamide, 1-methyl- is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a carboxamide functional group at the 3-position of the indole ring contributes to its potential biological activity. The methyl group at the 1-position enhances its lipophilicity, which can influence its interaction with biological targets. This compound is often studied for its pharmacological properties, including potential roles in neuropharmacology and as a scaffold for drug development. It may exhibit various activities, such as anti-inflammatory or neuroprotective effects, depending on its specific interactions within biological systems. Additionally, its solubility and stability can be affected by the presence of the carboxamide and methyl groups, making it a subject of interest in medicinal chemistry. Overall, 1H-Indole-3-carboxamide, 1-methyl- represents a versatile structure with implications in both synthetic and medicinal chemistry.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-12-6-8(10(11)13)7-4-2-3-5-9(7)12/h2-6H,1H3,(H2,11,13)
InChI key:UHQHFXKJFJHBAE-UHFFFAOYSA-N
SMILES:CN1C=C(C2=CC=CC=C21)C(=O)N
Found 3 products.