CAS 118971-03-2
:(S)-2-(Methoxydiphenylmethyl)pyrrolidine
Description:
(S)-2-(Methoxydiphenylmethyl)pyrrolidine, with the CAS number 118971-03-2, is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of the methoxydiphenylmethyl group contributes to its unique structural and stereochemical properties, influencing its reactivity and interactions with biological systems. This compound is typically used in medicinal chemistry and drug development due to its potential pharmacological activities. Its chirality suggests that it may exhibit different biological effects depending on the stereoisomer, making it important in the context of enantiomer-specific activity. The methoxy group enhances solubility and may affect the compound's lipophilicity, impacting its bioavailability. Additionally, the diphenylmethyl moiety can provide steric hindrance, which may influence the compound's binding affinity to biological targets. Overall, (S)-2-(Methoxydiphenylmethyl)pyrrolidine is of interest for its potential applications in pharmaceuticals, particularly in the development of selective agents in various therapeutic areas.
Formula:C18H21NO
InChI:InChI=1/C18H21NO/c1-20-18(17-13-8-14-19-17,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12,17,19H,8,13-14H2,1H3/t17-/m0/s1
SMILES:COC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1
Synonyms:- (2S)-2-[methoxy(diphenyl)methyl]pyrrolidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-2-(Methoxydiphenylmethyl)pyrrolidine
CAS:Formula:C18H21NOPurity:95%Color and Shape:LiquidMolecular weight:267.3654(2S)-2-(Methoxydiphenylmethyl)pyrrolidine
CAS:Controlled ProductApplications is an (2S)-2-(Methoxydiphenylmethyl)pyrrolidine intermediate in the synthesis of α-Zingiberene which is a sesquiterpine found in leaf glandular trichomes that is currently being evaluated for its cytotoxicity towards human tumour cell lines.
References Bou, D., et al.: Molecules, 18, 9477 (2013); Freitas, J., et al.: Euphytica, 127, 275 (2002)Formula:C18H21NOColor and Shape:NeatMolecular weight:267.37(S)-2-(Methoxydiphenylmethyl)pyrrolidine
CAS:Controlled ProductPlease enquire for more information about (S)-2-(Methoxydiphenylmethyl)pyrrolidine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C18H21NOPurity:Min. 95%Molecular weight:267.37 g/mol


