
CAS 1189729-41-6
:2,3,6-Tribromo-4-methylpyridine
Description:
2,3,6-Tribromo-4-methylpyridine is a brominated derivative of pyridine, characterized by the presence of three bromine atoms and a methyl group attached to the pyridine ring. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, reflecting the influence of the bromine substituents on its polarity. The presence of bromine atoms enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. The methyl group contributes to the compound's overall stability and influences its electronic properties. As a heterocyclic compound, it may also exhibit interesting biological activities, although specific biological data may vary. Safety considerations are important when handling this substance, as brominated compounds can be hazardous. Proper storage and disposal methods should be followed to mitigate environmental impact. Overall, 2,3,6-Tribromo-4-methylpyridine is a significant compound in organic chemistry with potential applications in multiple fields.
Formula:C6H4Br3N
InChI:InChI=1S/C6H4Br3N/c1-3-2-4(7)10-6(9)5(3)8/h2H,1H3
InChI key:InChIKey=YNGCAVXRNVZFIJ-UHFFFAOYSA-N
SMILES:BrC=1C(C)=CC(Br)=NC1Br
Synonyms:- Pyridine, 2,3,6-tribromo-4-methyl-
- 2,3,6-Tribromo-4-methylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.