CAS 1189749-35-6

4-(5-Bromo-2-fluorophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine

Description:

4-(5-Bromo-2-fluorophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a fused imidazopyridine ring system and a substituted phenyl group. The presence of bromine and fluorine atoms on the phenyl ring contributes to its unique electronic properties and potential reactivity. This compound is typically of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its tetrahydro structure indicates that it contains saturated carbon atoms, which can influence its solubility and stability. The imidazo[4,5-c]pyridine framework is known for its role in various biological activities, making this compound a candidate for further research in drug discovery. Additionally, the specific arrangement of substituents can affect its interaction with biological targets, leading to diverse pharmacological effects. As with many synthetic organic compounds, careful consideration of its synthesis, stability, and potential applications is essential in the context of chemical research and development.

Formula: C₁₂H₁₁BrFN₃

InChI: InChI=1S/C12H11BrFN3/c13-7-1-2-9(14)8(5-7)11-12-10(3-4-15-11)16-6-17-12/h1-2,5-6,11,15H,3-4H2,(H,16,17)

InChI key: InChIKey=AHHBGBXRCZNNPO-UHFFFAOYSA-N

SMILES: FC1=C(C2C3=C(NC=N3)CCN2)C=C(Br)C=C1

Synonyms:

• 3H-Imidazo[4,5-c]pyridine, 4-(5-bromo-2-fluorophenyl)-4,5,6,7-tetrahydro-
• 4-(5-Bromo-2-fluorophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine
• 4-(5-bromo-2-fluorophenyl)-3H,4H,5H,6H,7H-imidazo[4,5-c]pyridine