CymitQuimica logo

CAS 1189749-38-9

:

5-Chloro-2-phenoxy-3-pyridinecarboxylic acid

Description:
5-Chloro-2-phenoxy-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring, a carboxylic acid functional group, and a phenoxy group. The presence of the chlorine atom at the 5-position of the pyridine ring contributes to its reactivity and potential biological activity. This compound is typically used in the field of agrochemicals, particularly as a herbicide or plant growth regulator, due to its ability to interact with specific biochemical pathways in plants. Its solubility and stability in various solvents can vary, influencing its application in formulations. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Safety and handling considerations are essential, as with many chemical substances, due to potential toxicity or environmental impact. Overall, 5-Chloro-2-phenoxy-3-pyridinecarboxylic acid represents a significant compound in both agricultural and pharmaceutical research contexts.
Formula:C12H8ClNO3
InChI:InChI=1S/C12H8ClNO3/c13-8-6-10(12(15)16)11(14-7-8)17-9-4-2-1-3-5-9/h1-7H,(H,15,16)
InChI key:InChIKey=QBNAUPCRXCFGNI-UHFFFAOYSA-N
SMILES:O(C1=C(C(O)=O)C=C(Cl)C=N1)C2=CC=CC=C2
Synonyms:
  • 5-Chloro-2-phenoxy-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-chloro-2-phenoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.