CAS 1189749-39-0

Methyl 4,5-dichloro-1H-imidazole-1-acetate

Description:

Methyl 4,5-dichloro-1H-imidazole-1-acetate is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of dichloro substituents at the 4 and 5 positions of the imidazole ring contributes to its reactivity and potential biological activity. The acetate group attached to the nitrogen enhances its solubility in organic solvents and may influence its pharmacological properties. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential applications as a building block in the synthesis of more complex molecules. Its molecular structure suggests that it may exhibit antimicrobial or antifungal properties, although specific biological activities would need to be confirmed through empirical studies. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula: C₆H₆Cl₂N₂O₂

InChI: InChI=1S/C6H6Cl2N2O2/c1-12-4(11)2-10-3-9-5(7)6(10)8/h3H,2H2,1H3

InChI key: InChIKey=RFCZCRJMGOZVDG-UHFFFAOYSA-N

SMILES: C(C(OC)=O)N1C(Cl)=C(Cl)N=C1

Synonyms:

• Methyl 4,5-dichloro-1H-imidazole-1-acetate
• 1H-Imidazole-1-acetic acid, 4,5-dichloro-, methyl ester