CymitQuimica logo

CAS 1189749-50-5

:

5-Amino-3-methyl-7H-thiazolo[3,2-a]pyrimidin-7-one

Description:
5-Amino-3-methyl-7H-thiazolo[3,2-a]pyrimidin-7-one is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both thiazole and pyrimidine rings. This compound features an amino group at the 5-position and a methyl group at the 3-position of the thiazole ring, contributing to its chemical reactivity and potential biological activity. The presence of the thiazole moiety often imparts properties such as increased solubility and the ability to participate in various chemical reactions, including nucleophilic substitutions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the specific arrangement of functional groups may influence its pharmacokinetic properties, such as absorption and metabolism. Overall, 5-Amino-3-methyl-7H-thiazolo[3,2-a]pyrimidin-7-one represents a class of compounds that are of interest for further research in drug discovery and development.
Formula:C7H7N3OS
InChI:InChI=1S/C7H7N3OS/c1-4-3-12-7-9-6(11)2-5(8)10(4)7/h2-3H,8H2,1H3
InChI key:InChIKey=FZBCXDKITARKMX-UHFFFAOYSA-N
SMILES:NC=1N2C(=NC(=O)C1)SC=C2C
Synonyms:
  • 5-Amino-3-methyl-7H-thiazolo[3,2-a]pyrimidin-7-one
  • 7H-Thiazolo[3,2-a]pyrimidin-7-one, 5-amino-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.