CymitQuimica logo

CAS 1189749-61-8

:

4-Methyl-2-[[4-(1H-1,2,4-triazol-1-ylmethyl)phenyl]amino]-5-thiazolecarboxylic acid

Description:
4-Methyl-2-[[4-(1H-1,2,4-triazol-1-ylmethyl)phenyl]amino]-5-thiazolecarboxylic acid is a chemical compound characterized by its complex structure, which includes a thiazole ring, an amino group, and a triazole moiety. This compound is typically classified as an organic heterocyclic compound due to the presence of nitrogen and sulfur in its ring structures. It may exhibit properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or antifungal agents. The presence of the thiazole and triazole groups suggests that it may interact with biological targets through hydrogen bonding and other non-covalent interactions. Additionally, the methyl group contributes to its lipophilicity, which can influence its pharmacokinetic properties. As with many compounds in medicinal chemistry, its efficacy and safety profile would need to be evaluated through rigorous testing.
Formula:C14H13N5O2S
InChI:InChI=1S/C14H13N5O2S/c1-9-12(13(20)21)22-14(17-9)18-11-4-2-10(3-5-11)6-19-8-15-7-16-19/h2-5,7-8H,6H2,1H3,(H,17,18)(H,20,21)
InChI key:InChIKey=XGAFOLPEUDYGIR-UHFFFAOYSA-N
SMILES:N(C=1SC(C(O)=O)=C(C)N1)C2=CC=C(CN3C=NC=N3)C=C2
Synonyms:
  • 4-Methyl-2-[[4-(1H-1,2,4-triazol-1-ylmethyl)phenyl]amino]-5-thiazolecarboxylic acid
  • 5-Thiazolecarboxylic acid, 4-methyl-2-[[4-(1H-1,2,4-triazol-1-ylmethyl)phenyl]amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.