CymitQuimica logo

CAS 1189749-65-2

:

3-Amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide

Description:
3-Amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide is a chemical compound characterized by its unique structure, which includes an amino group and a thiadiazole ring. The presence of the thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. This compound features a benzamide backbone, which is known for its role in medicinal chemistry, particularly in the development of drugs. The methyl group on the thiadiazole ring can influence the compound's lipophilicity and overall reactivity. In terms of solubility, compounds with such structures may exhibit varying degrees of solubility in polar and non-polar solvents, depending on the functional groups present. The compound's molecular interactions, stability, and reactivity can be further influenced by its specific functional groups, making it a candidate for research in fields such as drug development and material science. Overall, 3-Amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide represents a class of compounds with potential applications in various chemical and biological contexts.
Formula:C10H10N4OS
InChI:InChI=1S/C10H10N4OS/c1-6-13-14-10(16-6)12-9(15)7-3-2-4-8(11)5-7/h2-5H,11H2,1H3,(H,12,14,15)
InChI key:InChIKey=KFASJMUGPCYEKL-UHFFFAOYSA-N
SMILES:C(NC=1SC(C)=NN1)(=O)C2=CC(N)=CC=C2
Synonyms:
  • Benzamide, 3-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)-
  • 3-Amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.