CAS 1189749-66-3

4-(3-Bromo-4-fluorophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine

Description:

4-(3-Bromo-4-fluorophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes an imidazopyridine core. This compound features a bromine and a fluorine substituent on a phenyl ring, contributing to its unique electronic and steric properties. The presence of these halogens can influence the compound's reactivity, solubility, and potential biological activity. The tetrahydro component indicates that the compound contains a saturated ring system, which may enhance its stability and lipophilicity. Such structural features often make it a candidate for pharmaceutical applications, particularly in the development of novel therapeutic agents. The compound's molecular interactions, including hydrogen bonding and π-π stacking, can play a significant role in its biological efficacy. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR, mass spectrometry, and possibly X-ray crystallography for structural confirmation. Overall, this compound exemplifies the intricate design often found in medicinal chemistry.

Formula: C₁₂H₁₁BrFN₃

InChI: InChI=1S/C12H11BrFN3/c13-8-5-7(1-2-9(8)14)11-12-10(3-4-15-11)16-6-17-12/h1-2,5-6,11,15H,3-4H2,(H,16,17)

InChI key: InChIKey=RNEIPFFKULXWEP-UHFFFAOYSA-N

SMILES: BrC=1C=C(C2C3=C(CCN2)NC=N3)C=CC1F

Synonyms:

• 3H-Imidazo[4,5-c]pyridine, 4-(3-bromo-4-fluorophenyl)-4,5,6,7-tetrahydro-
• 4-(3-Bromo-4-fluorophenyl)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine