CymitQuimica logo

CAS 1189749-77-6

:

3-(6-Chloro-1,2,4-triazolo[4,3-b]pyridazin-3-yl)-1-(1-pyrrolidinyl)-1-propanone

Description:
3-(6-Chloro-1,2,4-triazolo[4,3-b]pyridazin-3-yl)-1-(1-pyrrolidinyl)-1-propanone is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a pyridazine moiety, along with a propanone functional group. The presence of the chloro substituent enhances its reactivity and may influence its biological activity. The pyrrolidine group contributes to the compound's potential pharmacological properties, as it can interact with various biological targets. This compound is likely to exhibit specific solubility characteristics, stability under certain conditions, and potential for forming hydrogen bonds due to its functional groups. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses and safety profile. As with many synthetic compounds, proper handling and safety precautions should be observed during its use in research or industrial applications.
Formula:C12H14ClN5O
InChI:InChI=1S/C12H14ClN5O/c13-9-3-4-10-14-15-11(18(10)16-9)5-6-12(19)17-7-1-2-8-17/h3-4H,1-2,5-8H2
InChI key:InChIKey=GIPYEINKTPUBDN-UHFFFAOYSA-N
SMILES:C(CC(=O)N1CCCC1)C=2N3C(=NN2)C=CC(Cl)=N3
Synonyms:
  • 3-(6-Chloro-1,2,4-triazolo[4,3-b]pyridazin-3-yl)-1-(1-pyrrolidinyl)-1-propanone
  • 1-Propanone, 3-(6-chloro-1,2,4-triazolo[4,3-b]pyridazin-3-yl)-1-(1-pyrrolidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.