CAS 1189852-05-8

7-Chloro-2-methylpyrazolo[1,5-a]pyrimidin-5-amine

Description:

7-Chloro-2-methylpyrazolo[1,5-a]pyrimidin-5-amine is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a chlorine atom at the 7-position and a methyl group at the 2-position of the pyrazolo ring, along with an amino group at the 5-position of the pyrimidine ring. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure suggests potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's unique arrangement of atoms and functional groups may influence its reactivity and stability, making it a subject of study in various chemical and biological contexts. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₇H₇ClN₄

InChI: InChI=1S/C7H7ClN4/c1-4-2-7-10-6(9)3-5(8)12(7)11-4/h2-3H,1H3,(H2,9,10)

InChI key: InChIKey=VOWVPHOKWZLZLV-UHFFFAOYSA-N

SMILES: ClC=1N2C(=CC(C)=N2)N=C(N)C1

Synonyms:

• 7-Chloro-2-methylpyrazolo[1,5-〈a]pyrimidin-5-amine
• Pyrazolo[1,5-a]pyrimidin-5-amine, 7-chloro-2-methyl-
• 7-Chloro-2-methylpyrazolo[1,5-a]pyrimidin-5-amine

7-Chloro-2-methylpyrazolo[1,5-a]pyrimidin-5-amine

CAS: 1189852-05-8

Versatile small molecule scaffold

Formula: C₇H₇ClN₄

Purity: Min. 95%

Molecular weight: 182.61 g/mol

Ref: 3D-PXB85205