CAS 118993-65-0
:(4-methylphenyl)(thiophen-3-yl)methanone
Description:
(4-methylphenyl)(thiophen-3-yl)methanone, also known by its CAS number 118993-65-0, is an organic compound characterized by the presence of a ketone functional group attached to a thiophene ring and a para-methylphenyl group. This compound features a thiophene moiety, which is a five-membered aromatic ring containing sulfur, contributing to its unique electronic properties and potential applications in organic electronics and materials science. The para-methylphenyl group enhances the compound's hydrophobicity and may influence its solubility and reactivity. The overall structure suggests potential for various chemical reactions, including electrophilic substitutions and nucleophilic additions, making it of interest in synthetic organic chemistry. Additionally, the presence of both aromatic and heteroaromatic components may impart interesting photophysical properties, which could be explored in fields such as photochemistry and photophysics. Overall, (4-methylphenyl)(thiophen-3-yl)methanone is a compound of interest for its structural features and potential applications in various chemical and material science domains.
Formula:C12H10OS
InChI:InChI=1/C12H10OS/c1-9-2-4-10(5-3-9)12(13)11-6-7-14-8-11/h2-8H,1H3
SMILES:Cc1ccc(cc1)C(=O)c1ccsc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.