CAS 119-10-8
:1-Methoxy-4-methyl-2-nitrobenzene
Description:
1-Methoxy-4-methyl-2-nitrobenzene, also known as p-methoxy-m-nitrotoluene, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3), a methyl group (-CH3), and a nitro group (-NO2) attached to a benzene ring. This compound typically appears as a yellow to brown solid and is known for its moderate solubility in organic solvents, while being less soluble in water. It has a relatively high melting point and boiling point compared to many simple hydrocarbons, reflecting its stable aromatic system. The presence of the nitro group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the production of dyes and pharmaceuticals. Additionally, 1-Methoxy-4-methyl-2-nitrobenzene may exhibit toxicological properties, necessitating careful handling and appropriate safety measures during its use in laboratory or industrial settings. Its chemical behavior can be influenced by the electron-withdrawing nature of the nitro group and the electron-donating effect of the methoxy group, leading to unique reactivity patterns in electrophilic aromatic substitution reactions.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c1-6-3-4-8(12-2)7(5-6)9(10)11/h3-5H,1-2H3
InChI key:InChIKey=LGNMURXRPLMVJI-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(OC)C=CC(C)=C1
Synonyms:- 1-Methoxy-4-Methyl-2-Nitrobenzene
- 2-Nitro-4-methylanisole
- 4-Methoxy-3-nitrotoluene
- Anisole, 4-methyl-2-nitro-
- Benzene, 1-methoxy-4-methyl-2-nitro-
- Methoxynitrotoluene
- Methyl 2-Nitro-P-Tolyl Ether
- 4-Methyl-2-nitroanisole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Methoxy-3-nitrotoluene
CAS:Formula:C8H9NO3Purity:>98.0%(GC)Color and Shape:Colorless to Brown clear liquidMolecular weight:167.161-Methoxy-4-Methyl-2-Nitrobenzene
CAS:Formula:C8H9NO3Purity:98%Color and Shape:LiquidMolecular weight:167.16204-Methyl-2-nitroanisole
CAS:4-Methyl-2-nitroanisoleFormula:C8H9NO3Purity:98%Color and Shape: clear. yellow to light green liquidMolecular weight:167.16g/mol4-Methyl-2-nitroanisole
CAS:4-Methyl-2-nitroanisole (4NA) is a hydronium that has been shown to be an anticancer drug. It inhibits the growth of cancer cells by binding to reactive methoxy groups on the cell surface and promotes apoptosis, or programmed cell death. 4NA also produces nitric oxide, which may cause DNA damage in cancer cells. The mechanism of action for 4NA is not fully understood but it has been shown to have a radical mechanism of action which leads to the formation of reactive molecules that can react with other molecules in the cell, leading to DNA damage and cell death. Preparative methods for synthesizing 4NA are acidic and involve aldehydes and nitrites.
Formula:C8H9NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:167.16 g/mol1-Methoxy-4-methyl-2-nitrobenzene
CAS:Formula:C8H9NO3Purity:98%Color and Shape:SolidMolecular weight:167.1644-Methyl-2-nitroanisole
CAS:Controlled ProductFormula:C8H9NO3Color and Shape:YellowMolecular weight:167.16






