CAS 119-30-2
:5-Iodosalicylic acid
Description:
5-Iodosalicylic acid, with the CAS number 119-30-2, is an organic compound that belongs to the class of salicylic acids, characterized by the presence of both a hydroxyl group (-OH) and a carboxylic acid group (-COOH) on a benzene ring. Specifically, it features an iodine atom substituted at the 5-position of the salicylic acid structure. This compound typically appears as a white to off-white crystalline solid and is known for its solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. 5-Iodosalicylic acid exhibits various chemical properties, including the ability to participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the iodine substituent. It is often utilized in biochemical research and pharmaceutical applications, particularly for its potential anti-inflammatory and antimicrobial properties. Additionally, it can serve as a reagent in organic synthesis and analytical chemistry. Proper handling and storage are essential, as with many chemical substances, to ensure safety and stability.
Formula:C7H5IO3
InChI:InChI=1S/C7H5IO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,(H,10,11)
InChI key:InChIKey=SWDNKOFGNPGRPI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C=CC(I)=C1
Synonyms:- 2-Hydroxy-5-Iodobenzoate
- 2-Hydroxy-5-iodobenzoic acid
- 5-Iodo-2-hydroxybenzoic acid
- 5-Lodo-2-Hydroxy Benzoic Acid
- 6-Hydroxy-3-iodobenzoic acid
- Benzoic acid, 2-hydroxy-5-iodo-
- NSC 2789
- Salicylic acid, 5-iodo-
- 5-Iodosalicylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
5-Iodosalicylic Acid
CAS:Formula:C7H5IO3Purity:>98.0%(T)(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:264.025-Iodosalicylic acid, 97%
CAS:<p>2-hydroxy-5-iodobenzoic acid is a reagent in various organic chemical reactions leading to pharmaceutical compounds. It is involved in the synthesis of labeled benzamide analogs for tumor imaging as well as the synthesis of the dye, Congo Red, for biological analyses. This Thermo Scientific Chemical</p>Formula:C7H5IO3Purity:97%Color and Shape:White to cream to pale yellow, Crystals or powder or crystalline powderMolecular weight:264.022-Hydroxy-5-iodobenzoic acid
CAS:Formula:C7H5IO3Purity:95%Color and Shape:SolidMolecular weight:264.01735-Iodosalicylic acid
CAS:5-Iodosalicylic acidFormula:C7H5IO3Purity:99%Color and Shape: cream powderMolecular weight:264.02g/mol2-Hydroxy-5-iodobenzoic acid
CAS:Controlled Product<p>Applications 2-hydroxy-5-iodobenzoic Acid is a reagent in various organic chemical reactions leading to pharmaceutical compounds. It is involved in the synthesis of labelled benzamide analogs for tumor imaging as well as the synthesis of the dye, Congo Red, for biological analyses.<br>References Tu, Z. et al.: J. Med. Chem., 50, 3194 (2007); Sellarajah, S. et al.: J. Med. Chem., 47, 5515 (2004);<br></p>Formula:C7H5IO3Color and Shape:NeatMolecular weight:264.025-Iodo-2-hydroxybenzoic acid
CAS:<p>5-Iodo-2-hydroxybenzoic acid (5-IABA) is a molecule that has been shown to inhibit the growth of bladder cancer cells in vitro. FTIR spectroscopy and control experiments have confirmed that 5-IABA specifically binds to the cytochrome P450 heme, which is integral to the electron transport chain in the mitochondria. These studies also demonstrate that 5-IABA inhibits bacterial growth by binding to their cytochromes and preventing their electron transport. This makes this compound an excellent candidate for cancer treatment.</p>Formula:C7H5IO3Purity:Min. 95%Color and Shape:White To Light (Or Pale) Yellow SolidMolecular weight:264.02 g/mol
