CAS 119-77-7

p-Aminobenzoyl J Acid

Description:

p-Aminobenzoyl J Acid, also known as p-aminobenzoic acid (PABA), is an organic compound with the chemical formula C7H7NO2. It is characterized by the presence of an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a benzene ring, specifically at the para position. PABA is a white crystalline solid that is soluble in water and alcohol, but insoluble in non-polar solvents. It has a slightly bitter taste and is known for its role in the synthesis of folic acid in microorganisms. PABA is often used in sunscreen formulations due to its ability to absorb ultraviolet (UV) light, although its use has declined due to concerns about skin sensitivity and potential allergic reactions. Additionally, it serves as a precursor in the synthesis of various dyes and pharmaceuticals. PABA is also recognized for its role in the production of certain types of plastics and as a potential additive in cosmetics. Safety data indicates that while it is generally considered safe in low concentrations, excessive exposure may lead to skin irritation or allergic responses.

Formula: C₁₇H₁₄N₂O₅S

InChI: InChI=1S/C17H14N2O5S/c18-12-3-1-10(2-4-12)17(21)19-13-5-6-15-11(7-13)8-14(9-16(15)20)25(22,23)24/h1-9,20H,18H2,(H,19,21)(H,22,23,24)

InChI key: InChIKey=BRIUJVAXLMLKPY-UHFFFAOYSA-N

SMILES: OC=1C2=C(C=C(NC(=O)C3=CC=C(N)C=C3)C=C2)C=C(S(=O)(=O)O)C1

Synonyms:

• 2-Naphthalenesulfonic acid, 7-[(4-aminobenzoyl)amino]-4-hydroxy-
• 2-Naphthalenesulfonic acid, 7-(p-aminobenzamido)-4-hydroxy-
• 7-[(4-Aminobenzoyl)amino]-4-hydroxy-2-naphthalenesulfonic acid
• p-Aminobenzoyl I Acid
• 1-Naphthol-3-sulfonic acid, 6-(p-aminobenzamido)-

2-Naphthalenesulfonic acid, 7-[(4-aminobenzoyl)amino]-4-hydroxy-

CAS: 119-77-7

Formula: C₁₇H₁₄N₂O₅S

Molecular weight: 358.3685

Ref: IN-DA000OZP