CAS 119-88-0
:N-(5-amino-2-methoxyphenyl)benzamide
Description:
N-(5-amino-2-methoxyphenyl)benzamide, also known by its CAS number 119-88-0, is an organic compound characterized by its amide functional group and aromatic structure. This substance features a benzamide core, where a benzene ring is substituted with an amino group and a methoxy group at specific positions. The presence of the amino group contributes to its potential as a building block in pharmaceuticals and agrochemicals, while the methoxy group can influence its solubility and reactivity. Typically, compounds like this exhibit moderate to high melting points and may be soluble in organic solvents. The compound's structure suggests it may participate in hydrogen bonding due to the amine and carbonyl functionalities, which can affect its biological activity and interactions. Additionally, it may exhibit various chemical properties, including reactivity towards electrophiles and nucleophiles, making it useful in synthetic organic chemistry. Overall, N-(5-amino-2-methoxyphenyl)benzamide is of interest for its potential applications in medicinal chemistry and material science.
Formula:C14H14N2O2
InChI:InChI=1/C14H14N2O2/c1-18-13-8-7-11(15)9-12(13)16-14(17)10-5-3-2-4-6-10/h2-9H,15H2,1H3,(H,16,17)
SMILES:COc1ccc(cc1N=C(c1ccccc1)O)N
Synonyms:- Benzamide, N-(5-amino-2-methoxyphenyl)-
- N-(5-Amino-2-methoxyphenyl)benzamide
- UKRORGSYN-BB BBV-013474
- N-(5-amino-2-methoxyphenyl)benzamide(SALTDATA: FREE)
- CHEMBRDG-BB 4024647
- AKOS BBV-013474
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
