CAS 119-96-0
:N-[2-Hydroxy-5-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenyl]acetamide
Description:
N-[2-Hydroxy-5-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenyl]acetamide, with the CAS number 119-96-0, is a chemical compound that features a complex structure incorporating both dithiarsolane and phenolic components. This substance is characterized by the presence of a hydroxymethyl group and an acetamide functional group, which contribute to its potential reactivity and solubility properties. The dithiarsolane moiety suggests that it may exhibit unique redox properties, making it of interest in various chemical and biological applications. The hydroxyl groups in the structure can enhance hydrogen bonding capabilities, influencing its solubility in polar solvents. Additionally, the compound may possess biological activity, potentially serving as a pharmacophore in medicinal chemistry. Its stability, reactivity, and interaction with biological systems would depend on the specific conditions, such as pH and temperature. Overall, this compound represents a fascinating area of study within organosulfur chemistry and its applications in pharmaceuticals or materials science.
Formula:C11H14AsNO3S2
InChI:InChI=1S/C11H14AsNO3S2/c1-7(15)13-10-4-8(2-3-11(10)16)12-17-6-9(5-14)18-12/h2-4,9,14,16H,5-6H2,1H3,(H,13,15)
InChI key:InChIKey=MRUDSZSRLQAPOG-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C=C(C=CC1O)[As]2SC(CO)CS2
Synonyms:- Acetamide, N-[2-hydroxy-5-[4-(hydroxymethyl)-1,3,2-dithiarsolan-2-yl]phenyl]-
- 1,3,2-Dithiarsolane, acetamide deriv.
- Benzenearsonous acid, 3-acetamido-4-hydroxydithio-, cyclic (hydroxymethyl)ethylene ester
- 1-Propanol, 2,3-dimercapto-, cyclic 2,3-ester with 3-acetamido-4-hydroxydithiobenzenearsonous acid
- Benzenearsonous acid, 3-acetamido-4-hydroxydithio-, (hydroxymethyl)ethylene ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
