CymitQuimica logo

CAS 1190-39-2

:

Malonic Acid Dibutyl Ester

Description:
Malonic Acid Dibutyl Ester, with the CAS number 1190-39-2, is an organic compound classified as a diester. It is derived from malonic acid, where both carboxylic acid groups are esterified with butanol. This compound typically appears as a colorless to pale yellow liquid and is known for its low volatility and relatively high boiling point. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic butyl groups. Malonic Acid Dibutyl Ester is often used as a plasticizer in various polymer formulations, enhancing flexibility and durability. Additionally, it serves as an intermediate in organic synthesis, particularly in the production of other chemical compounds. The substance is generally considered to have low toxicity, but like many esters, it should be handled with care to avoid potential irritation. Its chemical structure allows for various applications in industrial and laboratory settings, making it a versatile compound in the field of organic chemistry.
Formula:C11H20O4
InChI:InChI=1/C11H20O4/c1-3-5-7-14-10(12)9-11(13)15-8-6-4-2/h3-9H2,1-2H3
InChI key:NFKGQHYUYGYHIS-UHFFFAOYSA-N
SMILES:CCCCOC(=O)CC(=O)OCCCC
Synonyms:
  • Malonic acid di-n-butyl ester
  • Malonicaciddinbutylester
  • Dibutyl Propanedioate
Found 5 products.