CymitQuimica logo

CAS 1190-48-3

:

Nε-Formyl-L-lysine

Description:
Nε-Formyl-L-lysine is a derivative of the amino acid lysine, characterized by the presence of a formyl group (-CHO) attached to the nitrogen atom of the ε-amino group. This modification alters its chemical properties and biological activity compared to standard lysine. The substance is typically a white to off-white solid and is soluble in polar solvents such as water and methanol, reflecting its polar nature due to the amino and formyl functional groups. Nε-Formyl-L-lysine is often used in biochemical research, particularly in studies involving protein modification and synthesis, as it can serve as a building block for peptide synthesis or as a reactive intermediate in various chemical reactions. Its structure allows it to participate in various interactions, including hydrogen bonding, which can influence its reactivity and stability. Additionally, it may have implications in biological systems, particularly in the context of lysine's role in protein structure and function.
Formula:C7H14N2O3
InChI:InChI=1S/C7H14N2O3/c8-6(7(11)12)3-1-2-4-9-5-10/h5-6H,1-4,8H2,(H,9,10)(H,11,12)/t6-/m0/s1
InChI key:InChIKey=KLPJXDPPMSJWKI-LURJTMIESA-N
SMILES:C([C@@H](C(O)=O)N)CCCNC=O
Synonyms:
  • Lysine, N6-formyl-
  • Lysine, N6-formyl-, L-
  • N6-Formyl-L-lysine
  • Nε-Formyllysine
  • L-Lysine, N6-formyl-
Found 4 products.