CymitQuimica logo

CAS 119008-53-6

:

(2R,5R)-1-benzyl-2,5-dimethylpyrrolidine

Description:
(2R,5R)-1-benzyl-2,5-dimethylpyrrolidine is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered saturated nitrogen-containing heterocycle. The presence of two methyl groups at the 2 and 5 positions of the ring contributes to its steric properties, while the benzyl group at the 1 position enhances its hydrophobic characteristics. This compound exhibits specific stereochemistry, indicated by the (2R,5R) configuration, which plays a crucial role in its biological activity and interactions. It is typically a colorless to pale yellow liquid or solid, depending on the conditions, and is soluble in organic solvents. The compound may be of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in various applications, including as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H19N
InChI:InChI=1/C13H19N/c1-11-8-9-12(2)14(11)10-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3/t11-,12-/m1/s1
SMILES:C[C@@H]1CC[C@@H](C)N1Cc1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.