
CAS 119015-50-8
:2,4-Dichloro-1-(2-methoxyethoxy)benzene
Description:
2,4-Dichloro-1-(2-methoxyethoxy)benzene, with the CAS number 119015-50-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms at the 2 and 4 positions and a 2-methoxyethoxy group at the 1 position. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic nature due to the aromatic and chlorinated components. The presence of the methoxyethoxy group enhances its potential for various applications, including as an intermediate in organic synthesis or in the formulation of agrochemicals. Additionally, the chlorine substituents may impart specific reactivity, making it useful in further chemical transformations. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C9H10Cl2O2
InChI:InChI=1S/C9H10Cl2O2/c1-12-4-5-13-9-3-2-7(10)6-8(9)11/h2-3,6H,4-5H2,1H3
InChI key:InChIKey=UXPXOISEGGABTB-UHFFFAOYSA-N
SMILES:O(CCOC)C1=C(Cl)C=C(Cl)C=C1
Synonyms:- Benzene, 2,4-dichloro-1-(2-methoxyethoxy)-
- Ethane, 1-(2,4-dichlorophenoxy)-2-methoxy-
- 2,4-Dichloro-1-(2-methoxyethoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
