CymitQuimica logo

CAS 119018-03-0

:

N-acetyl-S-(1,1-dibromo-2,2-difluoroethyl)-1-cysteine

Description:
N-acetyl-S-(1,1-dibromo-2,2-difluoroethyl)-1-cysteine is a synthetic compound that features a cysteine backbone modified with an N-acetyl group and a unique side chain containing dibromo and difluoro substituents. This compound is characterized by its potential reactivity due to the presence of halogenated groups, which can influence its biological activity and interactions with other molecules. The N-acetyl modification enhances its solubility and stability, making it more amenable for various applications, particularly in biochemical research. The presence of the sulfur atom in the cysteine moiety allows for potential thiol-related reactivity, which is significant in redox chemistry and protein interactions. Additionally, the halogenated ethyl group may impart unique properties, such as increased lipophilicity or altered pharmacokinetics. Overall, this compound's structure suggests it may be of interest in studies related to medicinal chemistry, environmental chemistry, or as a potential reagent in organic synthesis. However, specific safety and handling guidelines should be followed due to the presence of halogens.
Formula:C7H9Br2F2NO3S
InChI:InChI=1/C7H9Br2F2NO3S/c1-3(13)12-4(5(14)15)2-16-7(8,9)6(10)11/h4,6H,2H2,1H3,(H,12,13)(H,14,15)/t4-/m0/s1
SMILES:CC(=N[C@@H](CSC(C(F)F)(Br)Br)C(=O)O)O
Synonyms:
  • Dbdfe-nac
  • L-Cysteine, N-acetyl-S-(1,1-dibromo-2,2-difluoroethyl)-
  • N-acetyl-S-(1,1-dibromo-2,2-difluoroethyl)-L-cysteine
  • N-Acetyl-S-(1,1-dibromo-2,2-difluoroethyl)-1-cysteine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.