CAS 119018-04-1
:N-acetyl-S-(1,1,2,2-tetrafluoroethyl)-1-cysteine
Description:
N-acetyl-S-(1,1,2,2-tetrafluoroethyl)-1-cysteine is a synthetic compound that belongs to the class of cysteine derivatives. This substance features a cysteine backbone, which is an amino acid known for its thiol (-SH) group, modified by the addition of an N-acetyl group and a tetrafluoroethyl substituent. The presence of the tetrafluoroethyl group imparts unique properties, such as increased hydrophobicity and potential reactivity due to the fluorine atoms, which can influence the compound's behavior in biological systems and its interactions with other molecules. The N-acetyl modification enhances the stability and solubility of the compound, making it more amenable for various applications, including medicinal chemistry and biochemistry. Additionally, the compound may exhibit interesting pharmacological properties, although specific biological activities would depend on further empirical studies. As with many fluorinated compounds, it is essential to consider environmental and safety aspects due to the potential persistence and bioaccumulation of fluorinated substances.
Formula:C7H9F4NO3S
InChI:InChI=1/C7H9F4NO3S/c1-3(13)12-4(5(14)15)2-16-7(10,11)6(8)9/h4,6H,2H2,1H3,(H,12,13)(H,14,15)/t4-/m0/s1
SMILES:CC(=N[C@@H](CSC(C(F)F)(F)F)C(=O)O)O
Synonyms:- N-Acetyl-S-(1,1,2,2-Tetrafluoroethyl)-L-Cysteine
- N-Acetyl-S-Tetrafluoroethyl-L-Cysteine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.