CAS 119018-30-3: Methyl N-[[4-[2-[[(3-ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl]amino]ethyl]phenyl]sulfonyl]carbamate
Description:Methyl N-[[4-[2-[[(3-ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl]amino]ethyl]phenyl]sulfonyl]carbamate, with CAS number 119018-30-3, is a synthetic organic compound characterized by its complex structure, which includes a pyrrole ring, a sulfonyl group, and a carbamate moiety. This compound is typically utilized in pharmaceutical research and development, particularly in the context of drug design due to its potential biological activity. The presence of the sulfonyl group often enhances solubility and bioavailability, while the pyrrole ring can contribute to the compound's pharmacological properties. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. As with many synthetic compounds, its stability, reactivity, and biological effects would be influenced by various factors, including pH, temperature, and the presence of other chemical species. Safety and handling precautions are essential when working with this compound, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C18H23N3O6S
InChI:InChI=1S/C18H23N3O6S/c1-4-15-12(2)11-21(16(15)22)17(23)19-10-9-13-5-7-14(8-6-13)28(25,26)20-18(24)27-3/h5-8H,4,9-11H2,1-3H3,(H,19,23)(H,20,24)
InChI key:InChIKey=UZDRZEOOIXNUTE-UHFFFAOYSA-N
SMILES:O=C(OC)NS(=O)(=O)C1=CC=C(C=C1)CCNC(=O)N2C(=O)C(=C(C)C2)CC
- Synonyms:
- Methyl N-[[4-[2-[[(3-ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl]amino]ethyl]phenyl]sulfonyl]carbamate
- Carbamic acid, N-[[4-[2-[[(3-ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl]amino]ethyl]phenyl]sulfonyl]-, methyl ester
- Carbamic acid, [[4-[2-[[(3-ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl]amino]ethyl]phenyl]sulfonyl]-, methyl ester