CAS 1190198-14-1

Methyl 6-bromo-1,4-dihydro-4-oxo-8-quinolinecarboxylate

Description:

Methyl 6-bromo-1,4-dihydro-4-oxo-8-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a bromine atom at the 6-position and a carboxylate ester functional group, contributing to its reactivity and potential biological activity. The presence of the 1,4-dihydro-4-oxo moiety indicates that it exists in a reduced form, which can influence its chemical properties and interactions. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The methyl ester group enhances its solubility in organic solvents, which can be advantageous for synthesis and formulation. Additionally, the compound's structure suggests potential for further derivatization, allowing for the exploration of structure-activity relationships in drug development. Overall, Methyl 6-bromo-1,4-dihydro-4-oxo-8-quinolinecarboxylate represents a unique scaffold for research in organic and medicinal chemistry.

Formula: C₁₁H₈BrNO₃

InChI: InChI=1S/C11H8BrNO3/c1-16-11(15)8-5-6(12)4-7-9(14)2-3-13-10(7)8/h2-5H,1H3,(H,13,14)

InChI key: InChIKey=HPOKSZUNOICQEV-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=CC(Br)=C1)C(=O)C=CN2

Synonyms:

• Methyl 6-bromo-1,4-dihydro-4-oxo-8-quinolinecarboxylate
• 8-Quinolinecarboxylic acid, 6-bromo-1,4-dihydro-4-oxo-, methyl ester