CymitQuimica logo

CAS 1190198-18-5

:

5-Iodo-2-[(phenylmethyl)amino]-3-pyridinecarboxylic acid

Description:
5-Iodo-2-[(phenylmethyl)amino]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with an iodine atom and an amino group linked to a phenylmethyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate polarity due to the presence of the carboxylic acid functional group. The iodine substitution can influence its reactivity and biological activity, potentially enhancing its role in medicinal chemistry. The amino group may participate in hydrogen bonding, affecting its interaction with biological targets. Additionally, the presence of the carboxylic acid group suggests acidic properties, which can play a role in its behavior in various chemical environments. Overall, this compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its unique structural features and potential biological activities.
Formula:C13H11IN2O2
InChI:InChI=1S/C13H11IN2O2/c14-10-6-11(13(17)18)12(16-8-10)15-7-9-4-2-1-3-5-9/h1-6,8H,7H2,(H,15,16)(H,17,18)
InChI key:InChIKey=RJBSKVHDPIZBGQ-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)C2=C(C(O)=O)C=C(I)C=N2
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-iodo-2-[(phenylmethyl)amino]-
  • 5-Iodo-2-[(phenylmethyl)amino]-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.