CymitQuimica logo

CAS 1190198-19-6

:

Ethyl 5-iodo-2-[(phenylmethyl)amino]-3-pyridinecarboxylate

Description:
Ethyl 5-iodo-2-[(phenylmethyl)amino]-3-pyridinecarboxylate is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with an ethyl ester and an iodine atom. The presence of the phenylmethylamino group indicates that it has an amine functionality, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic phenyl group, which can influence its solubility in organic solvents. The iodine substituent may impart unique reactivity, making it a potential candidate for further chemical transformations, such as coupling reactions or as a precursor in the synthesis of other biologically active molecules. Additionally, the pyridine ring may contribute to its potential biological activity, as many pyridine derivatives are known for their pharmacological properties. Overall, this compound's unique structural features suggest it could be of interest in medicinal chemistry and organic synthesis.
Formula:C15H15IN2O2
InChI:InChI=1S/C15H15IN2O2/c1-2-20-15(19)13-8-12(16)10-18-14(13)17-9-11-6-4-3-5-7-11/h3-8,10H,2,9H2,1H3,(H,17,18)
InChI key:InChIKey=VAIZNBIRHWTRIC-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(NCC2=CC=CC=C2)N=CC(I)=C1
Synonyms:
  • 3-Pyridinecarboxylic acid, 5-iodo-2-[(phenylmethyl)amino]-, ethyl ester
  • Ethyl 5-iodo-2-[(phenylmethyl)amino]-3-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.